| dbo:abstract
|
- غونادوريلين (بالإنجليزية: Gonadorelin) هو دواء يُستعمل في علاج:
* انقطاع الحيض (ar)
- Gonadorelin is a gonadotropin-releasing hormone agonist (GnRH agonist) which is used in fertility medicine and to treat amenorrhea and hypogonadism. It is also used in veterinary medicine. The medication is a form of the endogenous GnRH and is identical to it in chemical structure. It is given by injection into a blood vessel or fat or as a nasal spray. (en)
|
| dbo:alternativeName
|
- Factrel, HRF, Kryptocur, Lutrelef, Lutrepulse, Relefact, others (en)
|
| dbo:casNumber
|
- 33515-09-2
- 51952-41-1 (hydrochloride)
- 71447-49-9 (diacetate)
|
| dbo:chEBI
| |
| dbo:chEMBL
| |
| dbo:class
| |
| dbo:drugbank
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 11786 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:atcSuffix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:casSupplemental
|
- 51952 (xsd:integer)
- 71447 (xsd:integer)
|
| dbp:chebi
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:drugbank
| |
| dbp:eliminationHalfLife
| |
| dbp:h
| |
| dbp:iupacName
|
- -N-[-1-[[-1-[[-1-[[-1-[[2-[[-1-[[-1-[-2-[carbamoyl]pyrrolidin-1-yl]-5--1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-3--1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3--1-oxopropan-2-yl]amino]-3--1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide (en)
|
| dbp:kegg
| |
| dbp:metabolism
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- CCC[C@@H]NCCNC[C@H]NC[C@H]NC[C@H]NC[C@H]NC[C@@H]6CCCN6 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- XLXSAKCOAKORKW-AQJXLSMYSA-N (en)
|
| dbp:synonyms
|
- Abbott 41070; AY-24031; Hoe-471; RU-19847 (en)
|
| dbp:tradename
|
- Factrel, HRF, Kryptocur, Lutrelef, Lutrepulse, Relefact, others (en)
|
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- غونادوريلين (بالإنجليزية: Gonadorelin) هو دواء يُستعمل في علاج:
* انقطاع الحيض (ar)
- Gonadorelin is a gonadotropin-releasing hormone agonist (GnRH agonist) which is used in fertility medicine and to treat amenorrhea and hypogonadism. It is also used in veterinary medicine. The medication is a form of the endogenous GnRH and is identical to it in chemical structure. It is given by injection into a blood vessel or fat or as a nasal spray. (en)
|
| rdfs:label
|
- غونادوريلين (ar)
- Gonadorelin (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
